C27H26F3N3O3 — CID 137361706
N-[5-[(4aR,6R)-6-methoxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide (PubChem CID 137361706) has the molecular formula C27H26F3N3O3 and a molecular weight of 497.52 g/mol. Its IUPAC name is N-[5-[(4aR,6R)-6-methoxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[(4aR,6R)-6-methoxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137361706 |
| Molecular Formula | C27H26F3N3O3 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | N-[5-[(4aR,6R)-6-methoxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide |
| SMILES | CO[C@@H]1C[C@@H]2COCCN2c2cc(-c3cc(NC(=O)c4cccc(C(F)(F)F)c4)cnc3C)ccc21 |
| InChI | InChI=1S/C27H26F3N3O3/c1-16-23(12-20(14-31-16)32-26(34)18-4-3-5-19(10-18)27(28,29)30)17-6-7-22-24(11-17)33-8-9-36-15-21(33)13-25(22)35-2/h3-7,10-12,14,21,25H,8-9,13,15H2,1-2H3,(H,32,34)/t21-,25-/m1/s1 |
| InChIKey | KTXZVMVCQTWDJK-PXDATVDWSA-N |
| XLogP | 5.62 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |