C24H21BrF2N4O5S — CID 137361993
1-[4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(2-methoxyethyl)urea (PubChem CID 137361993) has the molecular formula C24H21BrF2N4O5S and a molecular weight of 595.42 g/mol. Its IUPAC name is 1-[4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 137361993 |
| Molecular Formula | C24H21BrF2N4O5S |
| Molecular Weight | 595.42 g/mol |
| Exact Mass | 594.04 |
| IUPAC Name | 1-[4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1cc(F)c(Oc2ccnc3c2c(Br)cn3S(=O)(=O)c2ccc(C)cc2)c(F)c1 |
| InChI | InChI=1S/C24H21BrF2N4O5S/c1-14-3-5-16(6-4-14)37(33,34)31-13-17(25)21-20(7-8-28-23(21)31)36-22-18(26)11-15(12-19(22)27)30-24(32)29-9-10-35-2/h3-8,11-13H,9-10H2,1-2H3,(H2,29,30,32) |
| InChIKey | YZSJUTBSRSUEPI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|