C22H26N8O4 — CID 137362658
[(2S)-1-[2-[[1-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 137362658) has the molecular formula C22H26N8O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is [(2S)-1-[2-[[1-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[2-[[1-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 137362658 |
| Molecular Formula | C22H26N8O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [(2S)-1-[2-[[1-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(-n2cnc(Nc3nc(N4CCC[C@H]4CO)c4cccn4n3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26N8O4/c1-32-17-10-15(11-18(33-2)19(17)34-3)30-13-23-21(26-30)25-22-24-20(16-7-5-9-29(16)27-22)28-8-4-6-14(28)12-31/h5,7,9-11,13-14,31H,4,6,8,12H2,1-3H3,(H,25,26,27)/t14-/m0/s1 |
| InChIKey | XMMAKWPAMJXDNM-AWEZNQCLSA-N |
| XLogP | 2.04 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |