About 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline
4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline (PubChem CID 137362735) has the molecular formula C20H14BrF2N3O3S
and a molecular weight of 494.32 g/mol. Its IUPAC name is 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline.
Molecular Properties
| Compound Name | 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline |
| PubChem CID | 137362735 |
| Molecular Formula | C20H14BrF2N3O3S |
| Molecular Weight | 494.32 g/mol |
| Exact Mass | 492.99 |
| IUPAC Name | 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(Br)c3c(Oc4c(F)cc(N)cc4F)ccnc32)cc1 |
| InChI | InChI=1S/C20H14BrF2N3O3S/c1-11-2-4-13(5-3-11)30(27,28)26-10-14(21)18-17(6-7-25-20(18)26)29-19-15(22)8-12(24)9-16(19)23/h2-10H,24H2,1H3 |
| InChIKey | MPJBDIPVSINBIB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.32 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline?
The IUPAC name of 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline (CID 137362735) is 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline.
What is the SMILES notation for 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline?
The canonical SMILES for 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline is Cc1ccc(S(=O)(=O)n2cc(Br)c3c(Oc4c(F)cc(N)cc4F)ccnc32)cc1.
What is the InChIKey of 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline?
The InChIKey is MPJBDIPVSINBIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14BrF2N3O3S/c1-11-2-4-13(5-3-11)30(27,28)26-10-14(21)18-17(6-7-25-20(18)26)29-19-15(22)8-12(24)9-16(19)23/h2-10H,24H2,1H3.
What are the key properties of 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline?
4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline has a molecular weight of 494.32 g/mol, XLogP of 5.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluoroaniline is sourced from PubChem (CID 137362735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).