C25H24N6O4 — CID 137362783
[2-[4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]methanol (PubChem CID 137362783) has the molecular formula C25H24N6O4 and a molecular weight of 472.51 g/mol. Its IUPAC name is [2-[4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]methanol.
| Compound Name | [2-[4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 137362783 |
| Molecular Formula | C25H24N6O4 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [2-[4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]methanol |
| SMILES | COc1cc(-n2cnc(Nc3nc(-c4ccccc4CO)nn4cccc34)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N6O4/c1-33-20-11-17(12-21(34-2)23(20)35-3)30-13-22(26-15-30)27-25-19-9-6-10-31(19)29-24(28-25)18-8-5-4-7-16(18)14-32/h4-13,15,32H,14H2,1-3H3,(H,27,28,29) |
| InChIKey | IPJVMWCFJWINOH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |