C40H81N3O3 — CID 137362794
4-[[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]amino]butyl pentanoate (PubChem CID 137362794) has the molecular formula C40H81N3O3 and a molecular weight of 652.11 g/mol. Its IUPAC name is 4-[[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]amino]butyl pentanoate.
| Compound Name | 4-[[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]amino]butyl pentanoate |
|---|---|
| PubChem CID | 137362794 |
| Molecular Formula | C40H81N3O3 |
| Molecular Weight | 652.11 g/mol |
| Exact Mass | 651.63 |
| IUPAC Name | 4-[[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]amino]butyl pentanoate |
| SMILES | CCCCCCCCCN(CCCCCCCCC)CCN(CCCCCCCCC)CC(=O)NCCCCOC(=O)CCCC |
| InChI | InChI=1S/C40H81N3O3/c1-5-9-13-16-19-22-26-32-42(33-27-23-20-17-14-10-6-2)35-36-43(34-28-24-21-18-15-11-7-3)38-39(44)41-31-25-29-37-46-40(45)30-12-8-4/h5-38H2,1-4H3,(H,41,44) |
| InChIKey | GHERBPUZWYHHBO-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.11 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|