C22H23ClF3N5O3 — CID 137363031
1-[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3-(trifluoromethyl)phenyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 137363031) has the molecular formula C22H23ClF3N5O3 and a molecular weight of 497.91 g/mol. Its IUPAC name is 1-[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3-(trifluoromethyl)phenyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3-(trifluoromethyl)phenyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 137363031 |
| Molecular Formula | C22H23ClF3N5O3 |
| Molecular Weight | 497.91 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 1-[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3-(trifluoromethyl)phenyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | O=C(NCCCN1CCOCC1)Nc1ccc(Oc2ccnc3[nH]cc(Cl)c23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23ClF3N5O3/c23-16-13-29-20-19(16)18(4-6-27-20)34-17-3-2-14(12-15(17)22(24,25)26)30-21(32)28-5-1-7-31-8-10-33-11-9-31/h2-4,6,12-13H,1,5,7-11H2,(H,27,29)(H2,28,30,32) |
| InChIKey | REDAJHGUHLSNIL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|