About N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide
N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide (PubChem CID 137363041) has the molecular formula C17H20N4O5
and a molecular weight of 360.37 g/mol. Its IUPAC name is N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide |
| PubChem CID | 137363041 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide |
| SMILES | COc1cc(-n2cnc([N+](=O)[O-])c2)cc(C(=O)NC2CCCC2)c1OC |
| InChI | InChI=1S/C17H20N4O5/c1-25-14-8-12(20-9-15(18-10-20)21(23)24)7-13(16(14)26-2)17(22)19-11-5-3-4-6-11/h7-11H,3-6H2,1-2H3,(H,19,22) |
| InChIKey | AWTQPCNRLZUFBR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide?
The IUPAC name of N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide (CID 137363041) is N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide.
What is the SMILES notation for N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide?
The canonical SMILES for N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide is COc1cc(-n2cnc([N+](=O)[O-])c2)cc(C(=O)NC2CCCC2)c1OC.
What is the InChIKey of N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide?
The InChIKey is AWTQPCNRLZUFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O5/c1-25-14-8-12(20-9-15(18-10-20)21(23)24)7-13(16(14)26-2)17(22)19-11-5-3-4-6-11/h7-11H,3-6H2,1-2H3,(H,19,22).
What are the key properties of N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide?
N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide has a molecular weight of 360.37 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2,3-dimethoxy-5-(4-nitroimidazol-1-yl)benzamide is sourced from PubChem (CID 137363041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).