C21H19F2N7O3 — CID 137363150
[(2S)-1-[4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 137363150) has the molecular formula C21H19F2N7O3 and a molecular weight of 455.43 g/mol. Its IUPAC name is [(2S)-1-[4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 137363150 |
| Molecular Formula | C21H19F2N7O3 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | [(2S)-1-[4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1c1nc(Nc2cn(-c3ccc4c(c3)OC(F)(F)O4)cn2)c2cccn2n1 |
| InChI | InChI=1S/C21H19F2N7O3/c22-21(23)32-16-6-5-13(9-17(16)33-21)28-10-18(24-12-28)25-19-15-4-2-8-30(15)27-20(26-19)29-7-1-3-14(29)11-31/h2,4-6,8-10,12,14,31H,1,3,7,11H2,(H,25,26,27)/t14-/m0/s1 |
| InChIKey | DZQHPEJWBYMOQT-AWEZNQCLSA-N |
| XLogP | 2.94 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |