C29H37N9O4 — CID 137363414
1-[7-(piperidin-1-ylmethyl)-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidine-2-carboxamide (PubChem CID 137363414) has the molecular formula C29H37N9O4 and a molecular weight of 575.67 g/mol. Its IUPAC name is 1-[7-(piperidin-1-ylmethyl)-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[7-(piperidin-1-ylmethyl)-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 137363414 |
| Molecular Formula | C29H37N9O4 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | 1-[7-(piperidin-1-ylmethyl)-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidine-2-carboxamide |
| SMILES | COc1cc(-n2cnc(Nc3nc(N4CCCC4C(N)=O)nn4c(CN5CCCCC5)ccc34)c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H37N9O4/c1-40-23-14-20(15-24(41-2)26(23)42-3)36-17-25(31-18-36)32-28-22-10-9-19(16-35-11-5-4-6-12-35)38(22)34-29(33-28)37-13-7-8-21(37)27(30)39/h9-10,14-15,17-18,21H,4-8,11-13,16H2,1-3H3,(H2,30,39)(H,32,33,34) |
| InChIKey | GHBJCIDSHNPJAQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |