C29H38N8O4 — CID 137363457
[(2S)-1-[7-(piperidin-1-ylmethyl)-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 137363457) has the molecular formula C29H38N8O4 and a molecular weight of 562.68 g/mol. Its IUPAC name is [(2S)-1-[7-(piperidin-1-ylmethyl)-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[7-(piperidin-1-ylmethyl)-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 137363457 |
| Molecular Formula | C29H38N8O4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | [(2S)-1-[7-(piperidin-1-ylmethyl)-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(-n2cnc(Nc3nc(N4CCC[C@H]4CO)nn4c(CN5CCCCC5)ccc34)c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H38N8O4/c1-39-24-14-22(15-25(40-2)27(24)41-3)35-17-26(30-19-35)31-28-23-10-9-20(16-34-11-5-4-6-12-34)37(23)33-29(32-28)36-13-7-8-21(36)18-38/h9-10,14-15,17,19,21,38H,4-8,11-13,16,18H2,1-3H3,(H,31,32,33)/t21-/m0/s1 |
| InChIKey | CINKATNJNBTLKU-NRFANRHFSA-N |
| XLogP | 3.63 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |