C23H27N7O4 — CID 137363475
[(2R)-1-[2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 137363475) has the molecular formula C23H27N7O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is [(2R)-1-[2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 137363475 |
| Molecular Formula | C23H27N7O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | [(2R)-1-[2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(-n2cnc(Nc3nc(N4CCC[C@@H]4CO)c4cccn4n3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N7O4/c1-32-18-10-16(11-19(33-2)21(18)34-3)28-12-20(24-14-28)25-23-26-22(17-7-5-9-30(17)27-23)29-8-4-6-15(29)13-31/h5,7,9-12,14-15,31H,4,6,8,13H2,1-3H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | YLMGOYVERDVZER-OAHLLOKOSA-N |
| XLogP | 2.65 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |