C28H36N8O4 — CID 137363533
[(2S)-1-[7-[(cyclopropylmethylamino)methyl]-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 137363533) has the molecular formula C28H36N8O4 and a molecular weight of 548.65 g/mol. Its IUPAC name is [(2S)-1-[7-[(cyclopropylmethylamino)methyl]-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[7-[(cyclopropylmethylamino)methyl]-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 137363533 |
| Molecular Formula | C28H36N8O4 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | [(2S)-1-[7-[(cyclopropylmethylamino)methyl]-4-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(-n2cnc(Nc3nc(N4CCC[C@H]4CO)nn4c(CNCC5CC5)ccc34)c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H36N8O4/c1-38-23-11-21(12-24(39-2)26(23)40-3)34-15-25(30-17-34)31-27-22-9-8-19(14-29-13-18-6-7-18)36(22)33-28(32-27)35-10-4-5-20(35)16-37/h8-9,11-12,15,17-18,20,29,37H,4-7,10,13-14,16H2,1-3H3,(H,31,32,33)/t20-/m0/s1 |
| InChIKey | UDVNIYZGCZONKF-FQEVSTJZSA-N |
| XLogP | 3.15 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |