C25H29N7O4 — CID 137363804
[(6S)-5-[2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-5-azaspiro[2.4]heptan-6-yl]methanol (PubChem CID 137363804) has the molecular formula C25H29N7O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is [(6S)-5-[2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-5-azaspiro[2.4]heptan-6-yl]methanol.
| Compound Name | [(6S)-5-[2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-5-azaspiro[2.4]heptan-6-yl]methanol |
|---|---|
| PubChem CID | 137363804 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | [(6S)-5-[2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-5-azaspiro[2.4]heptan-6-yl]methanol |
| SMILES | COc1cc(-n2cnc(Nc3nc(N4CC5(CC5)C[C@H]4CO)c4cccn4n3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H29N7O4/c1-34-19-9-16(10-20(35-2)22(19)36-3)30-12-21(26-15-30)27-24-28-23(18-5-4-8-32(18)29-24)31-14-25(6-7-25)11-17(31)13-33/h4-5,8-10,12,15,17,33H,6-7,11,13-14H2,1-3H3,(H,27,29)/t17-/m0/s1 |
| InChIKey | WSLJSDXVCFQKSX-KRWDZBQOSA-N |
| XLogP | 3.04 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |