About 2-ethylcyclohexan-1-one;formic acid
2-ethylcyclohexan-1-one;formic acid (PubChem CID 137364111) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-ethylcyclohexan-1-one;formic acid.
Molecular Properties
| Compound Name | 2-ethylcyclohexan-1-one;formic acid |
| PubChem CID | 137364111 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-ethylcyclohexan-1-one;formic acid |
| SMILES | CCC1CCCCC1=O.O=CO |
| InChI | InChI=1S/C8H14O.CH2O2/c1-2-7-5-3-4-6-8(7)9;2-1-3/h7H,2-6H2,1H3;1H,(H,2,3) |
| InChIKey | NRXRZFXLNNVUIJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylcyclohexan-1-one;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylcyclohexan-1-one;formic acid?
The IUPAC name of 2-ethylcyclohexan-1-one;formic acid (CID 137364111) is 2-ethylcyclohexan-1-one;formic acid.
What is the SMILES notation for 2-ethylcyclohexan-1-one;formic acid?
The canonical SMILES for 2-ethylcyclohexan-1-one;formic acid is CCC1CCCCC1=O.O=CO.
What is the InChIKey of 2-ethylcyclohexan-1-one;formic acid?
The InChIKey is NRXRZFXLNNVUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.CH2O2/c1-2-7-5-3-4-6-8(7)9;2-1-3/h7H,2-6H2,1H3;1H,(H,2,3).
What are the key properties of 2-ethylcyclohexan-1-one;formic acid?
2-ethylcyclohexan-1-one;formic acid has a molecular weight of 172.22 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylcyclohexan-1-one;formic acid is sourced from PubChem (CID 137364111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).