C12H14ClFN2O3 — CID 137364287
(3S)-3-[(6-chloro-5-fluoro-3-pyridinyl)oxymethyl]piperidine-1-carboxylic acid (PubChem CID 137364287) has the molecular formula C12H14ClFN2O3 and a molecular weight of 288.71 g/mol. Its IUPAC name is (3S)-3-[(6-chloro-5-fluoro-3-pyridinyl)oxymethyl]piperidine-1-carboxylic acid.
| Compound Name | (3S)-3-[(6-chloro-5-fluoro-3-pyridinyl)oxymethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 137364287 |
| Molecular Formula | C12H14ClFN2O3 |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (3S)-3-[(6-chloro-5-fluoro-3-pyridinyl)oxymethyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC[C@H](COc2cnc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C12H14ClFN2O3/c13-11-10(14)4-9(5-15-11)19-7-8-2-1-3-16(6-8)12(17)18/h4-5,8H,1-3,6-7H2,(H,17,18)/t8-/m0/s1 |
| InChIKey | FFTJYTLVLDEPTL-QMMMGPOBSA-N |
| XLogP | 2.64 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|