C31H27F6N5O3 — CID 137365245
5-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(2-methoxy-4-methylphenoxy)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 137365245) has the molecular formula C31H27F6N5O3 and a molecular weight of 631.58 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(2-methoxy-4-methylphenoxy)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(2-methoxy-4-methylphenoxy)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 137365245 |
| Molecular Formula | C31H27F6N5O3 |
| Molecular Weight | 631.58 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(2-methoxy-4-methylphenoxy)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | COc1cc(C)ccc1Oc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1/N=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H27F6N5O3/c1-19-3-8-26(27(13-19)43-2)45-28-25(38-17-20-14-21(30(32,33)34)16-22(15-20)31(35,36)37)18-39-29(41-28)40-23-4-6-24(7-5-23)42-9-11-44-12-10-42/h3-8,13-18H,9-12H2,1-2H3,(H,39,40,41)/b38-17+ |
| InChIKey | KNRNYBHXYQQTST-OAQMXIGCSA-N |
| XLogP | 7.95 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.58 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|