C12H15N5O5 — CID 137365459
[(3,7-dimethyl-2,6-dioxopurin-8-yl)-(oxetan-3-yl)methyl]carbamic acid (PubChem CID 137365459) has the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. Its IUPAC name is [(3,7-dimethyl-2,6-dioxopurin-8-yl)-(oxetan-3-yl)methyl]carbamic acid.
| Compound Name | [(3,7-dimethyl-2,6-dioxopurin-8-yl)-(oxetan-3-yl)methyl]carbamic acid |
|---|---|
| PubChem CID | 137365459 |
| Molecular Formula | C12H15N5O5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | [(3,7-dimethyl-2,6-dioxopurin-8-yl)-(oxetan-3-yl)methyl]carbamic acid |
| SMILES | Cn1c(C(NC(=O)O)C2COC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C12H15N5O5/c1-16-7-9(17(2)11(19)15-10(7)18)14-8(16)6(13-12(20)21)5-3-22-4-5/h5-6,13H,3-4H2,1-2H3,(H,20,21)(H,15,18,19) |
| InChIKey | QOQGUOFXQBEOSG-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |