C26H26Cl2F5N3O5 — CID 137365882
(2S)-2-[[2-(3,4-dichlorophenyl)-2,2-difluoroacetyl]amino]-N-[(1S)-1-(4-methoxyphenyl)-2-oxo-2-[[(3S)-1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl]amino]ethyl]propanamide (PubChem CID 137365882) has the molecular formula C26H26Cl2F5N3O5 and a molecular weight of 626.41 g/mol. Its IUPAC name is (2S)-2-[[2-(3,4-dichlorophenyl)-2,2-difluoroacetyl]amino]-N-[(1S)-1-(4-methoxyphenyl)-2-oxo-2-[[(3S)-1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl]amino]ethyl]propanamide.
| Compound Name | (2S)-2-[[2-(3,4-dichlorophenyl)-2,2-difluoroacetyl]amino]-N-[(1S)-1-(4-methoxyphenyl)-2-oxo-2-[[(3S)-1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 137365882 |
| Molecular Formula | C26H26Cl2F5N3O5 |
| Molecular Weight | 626.41 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | (2S)-2-[[2-(3,4-dichlorophenyl)-2,2-difluoroacetyl]amino]-N-[(1S)-1-(4-methoxyphenyl)-2-oxo-2-[[(3S)-1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl]amino]ethyl]propanamide |
| SMILES | COc1ccc([C@H](NC(=O)[C@H](C)NC(=O)C(F)(F)c2ccc(Cl)c(Cl)c2)C(=O)N[C@H](C(=O)C(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C26H26Cl2F5N3O5/c1-12(2)19(21(37)26(31,32)33)35-23(39)20(14-5-8-16(41-4)9-6-14)36-22(38)13(3)34-24(40)25(29,30)15-7-10-17(27)18(28)11-15/h5-13,19-20H,1-4H3,(H,34,40)(H,35,39)(H,36,38)/t13-,19-,20-/m0/s1 |
| InChIKey | HJRSYDRJNIPOFC-MRFFXTKBSA-N |
| XLogP | 4.73 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |