C11H20N2O2 — CID 137366133
[1-[(7S)-5-azaspiro[2.4]heptan-7-yl]-2-methylpropan-2-yl] carbamate (PubChem CID 137366133) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is [1-[(7S)-5-azaspiro[2.4]heptan-7-yl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[(7S)-5-azaspiro[2.4]heptan-7-yl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 137366133 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [1-[(7S)-5-azaspiro[2.4]heptan-7-yl]-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)(C[C@@H]1CNCC12CC2)OC(N)=O |
| InChI | InChI=1S/C11H20N2O2/c1-10(2,15-9(12)14)5-8-6-13-7-11(8)3-4-11/h8,13H,3-7H2,1-2H3,(H2,12,14)/t8-/m1/s1 |
| InChIKey | LXQLZONZNJBSER-MRVPVSSYSA-N |
| XLogP | 1.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |