C22H23ClN8O2 — CID 137366379
8-[(7R)-6-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-7-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 137366379) has the molecular formula C22H23ClN8O2 and a molecular weight of 466.93 g/mol. Its IUPAC name is 8-[(7R)-6-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-7-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(7R)-6-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-7-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 137366379 |
| Molecular Formula | C22H23ClN8O2 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 8-[(7R)-6-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-7-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1Cc2ncnc(N3CCC4(CC3)NC(=O)NC4=O)c2CN1c1cc(Cl)nc2[nH]ccc12 |
| InChI | InChI=1S/C22H23ClN8O2/c1-12-8-15-14(10-31(12)16-9-17(23)27-18-13(16)2-5-24-18)19(26-11-25-15)30-6-3-22(4-7-30)20(32)28-21(33)29-22/h2,5,9,11-12H,3-4,6-8,10H2,1H3,(H,24,27)(H2,28,29,32,33)/t12-/m1/s1 |
| InChIKey | PAFHHIVZHMMQDM-GFCCVEGCSA-N |
| XLogP | 2.14 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|