C13H23NO6 — CID 137366429
3-[(3-methoxy-3-oxopropyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (PubChem CID 137366429) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-[(3-methoxy-3-oxopropyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid.
| Compound Name | 3-[(3-methoxy-3-oxopropyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 137366429 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-[(3-methoxy-3-oxopropyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| SMILES | COC(=O)CCN(C(=O)OC(C)(C)C)C(C)CC(=O)O |
| InChI | InChI=1S/C13H23NO6/c1-9(8-10(15)16)14(7-6-11(17)19-5)12(18)20-13(2,3)4/h9H,6-8H2,1-5H3,(H,15,16) |
| InChIKey | CYFKOJUDNVVQII-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |