About 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid
1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid (PubChem CID 137366935) has the molecular formula C14H20N2O3S
and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid.
Molecular Properties
| Compound Name | 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid |
| PubChem CID | 137366935 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid |
| SMILES | CC(CN1CCS(=O)CC1c1ccccc1)NC(=O)O |
| InChI | InChI=1S/C14H20N2O3S/c1-11(15-14(17)18)9-16-7-8-20(19)10-13(16)12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3,(H,17,18) |
| InChIKey | UCAPJSBOIJOHFD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid?
The IUPAC name of 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid (CID 137366935) is 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid.
What is the SMILES notation for 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid?
The canonical SMILES for 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid is CC(CN1CCS(=O)CC1c1ccccc1)NC(=O)O.
What is the InChIKey of 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid?
The InChIKey is UCAPJSBOIJOHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3S/c1-11(15-14(17)18)9-16-7-8-20(19)10-13(16)12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3,(H,17,18).
What are the key properties of 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid?
1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid has a molecular weight of 296.39 g/mol, XLogP of 1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-oxo-3-phenyl-1,4-thiazinan-4-yl)propan-2-ylcarbamic acid is sourced from PubChem (CID 137366935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).