C7H11NO4 — CID 137367540
(2R,3S)-2-methylpyrrolidine-1,3-dicarboxylic acid (PubChem CID 137367540) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is (2R,3S)-2-methylpyrrolidine-1,3-dicarboxylic acid.
| Compound Name | (2R,3S)-2-methylpyrrolidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 137367540 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (2R,3S)-2-methylpyrrolidine-1,3-dicarboxylic acid |
| SMILES | C[C@@H]1[C@@H](C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C7H11NO4/c1-4-5(6(9)10)2-3-8(4)7(11)12/h4-5H,2-3H2,1H3,(H,9,10)(H,11,12)/t4-,5+/m1/s1 |
| InChIKey | ZHPNZZARVXJZAG-UHNVWZDZSA-N |
| XLogP | 0.46 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |