C20H18Cl3N5O — CID 137368591
1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-4-[(2,4-dichlorophenyl)methyl]-3-propylimidazol-2-one (PubChem CID 137368591) has the molecular formula C20H18Cl3N5O and a molecular weight of 450.76 g/mol. Its IUPAC name is 1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-4-[(2,4-dichlorophenyl)methyl]-3-propylimidazol-2-one.
| Compound Name | 1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-4-[(2,4-dichlorophenyl)methyl]-3-propylimidazol-2-one |
|---|---|
| PubChem CID | 137368591 |
| Molecular Formula | C20H18Cl3N5O |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-4-[(2,4-dichlorophenyl)methyl]-3-propylimidazol-2-one |
| SMILES | CCCn1c(Cc2ccc(Cl)cc2Cl)cn(Cc2nc3nc(Cl)ccc3[nH]2)c1=O |
| InChI | InChI=1S/C20H18Cl3N5O/c1-2-7-28-14(8-12-3-4-13(21)9-15(12)22)10-27(20(28)29)11-18-24-16-5-6-17(23)25-19(16)26-18/h3-6,9-10H,2,7-8,11H2,1H3,(H,24,25,26) |
| InChIKey | YKBVQFYYYFIMNX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|