C23H20ClFN4O — CID 137368720
8-(2-chloro-4-methoxyphenyl)-2-[(5-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 137368720) has the molecular formula C23H20ClFN4O and a molecular weight of 422.89 g/mol. Its IUPAC name is 8-(2-chloro-4-methoxyphenyl)-2-[(5-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 8-(2-chloro-4-methoxyphenyl)-2-[(5-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 137368720 |
| Molecular Formula | C23H20ClFN4O |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 8-(2-chloro-4-methoxyphenyl)-2-[(5-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(-c2cccc3c2CN(Cc2nc4nc(F)ccc4[nH]2)CC3)c(Cl)c1 |
| InChI | InChI=1S/C23H20ClFN4O/c1-30-15-5-6-17(19(24)11-15)16-4-2-3-14-9-10-29(12-18(14)16)13-22-26-20-7-8-21(25)27-23(20)28-22/h2-8,11H,9-10,12-13H2,1H3,(H,26,27,28) |
| InChIKey | FSAHBTGFIJCQOY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|