C77H41F12N5O2 — CID 137368754
3,5-bis[2,7-bis(trifluoromethyl)carbazol-9-yl]-2,6-bis(2-phenoxazin-10-ylphenyl)-4-phenylbenzonitrile (PubChem CID 137368754) has the molecular formula C77H41F12N5O2 and a molecular weight of 1296.18 g/mol. Its IUPAC name is 3,5-bis[2,7-bis(trifluoromethyl)carbazol-9-yl]-2,6-bis(2-phenoxazin-10-ylphenyl)-4-phenylbenzonitrile.
| Compound Name | 3,5-bis[2,7-bis(trifluoromethyl)carbazol-9-yl]-2,6-bis(2-phenoxazin-10-ylphenyl)-4-phenylbenzonitrile |
|---|---|
| PubChem CID | 137368754 |
| Molecular Formula | C77H41F12N5O2 |
| Molecular Weight | 1296.18 g/mol |
| Exact Mass | 1295.31 |
| IUPAC Name | 3,5-bis[2,7-bis(trifluoromethyl)carbazol-9-yl]-2,6-bis(2-phenoxazin-10-ylphenyl)-4-phenylbenzonitrile |
| SMILES | N#Cc1c(-c2ccccc2N2c3ccccc3Oc3ccccc32)c(-n2c3cc(C(F)(F)F)ccc3c3ccc(C(F)(F)F)cc32)c(-c2ccccc2)c(-n2c3cc(C(F)(F)F)ccc3c3ccc(C(F)(F)F)cc32)c1-c1ccccc1N1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C77H41F12N5O2/c78-74(79,80)44-30-34-48-49-35-31-45(75(81,82)83)39-62(49)93(61(48)38-44)72-69(43-16-2-1-3-17-43)73(94-63-40-46(76(84,85)86)32-36-50(63)51-37-33-47(41-64(51)94)77(87,88)89)71(53-19-5-7-21-56(53)92-59-24-10-14-28-67(59)96-68-29-15-11-25-60(68)92)54(42-90)70(72)52-18-4-6-20-55(52)91-57-22-8-12-26-65(57)95-66-27-13-9-23-58(66)91/h1-41H |
| InChIKey | SYZLIGBJBXLBGQ-UHFFFAOYSA-N |
| XLogP | 23.98 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1296.18 |
| LogP ≤ 5 | 23.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |