C59H30F12N4O — CID 137368766
3,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-phenoxazin-10-yl-2,6-diphenylbenzonitrile (PubChem CID 137368766) has the molecular formula C59H30F12N4O and a molecular weight of 1038.89 g/mol. Its IUPAC name is 3,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-phenoxazin-10-yl-2,6-diphenylbenzonitrile.
| Compound Name | 3,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-phenoxazin-10-yl-2,6-diphenylbenzonitrile |
|---|---|
| PubChem CID | 137368766 |
| Molecular Formula | C59H30F12N4O |
| Molecular Weight | 1038.89 g/mol |
| Exact Mass | 1038.22 |
| IUPAC Name | 3,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-phenoxazin-10-yl-2,6-diphenylbenzonitrile |
| SMILES | N#Cc1c(-c2ccccc2)c(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c(N2c3ccccc3Oc3ccccc32)c(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c1-c1ccccc1 |
| InChI | InChI=1S/C59H30F12N4O/c60-56(61,62)34-19-23-43-38(27-34)39-28-35(57(63,64)65)20-24-44(39)73(43)53-51(32-11-3-1-4-12-32)42(31-72)52(33-13-5-2-6-14-33)54(55(53)75-47-15-7-9-17-49(47)76-50-18-10-8-16-48(50)75)74-45-25-21-36(58(66,67)68)29-40(45)41-30-37(59(69,70)71)22-26-46(41)74/h1-30H |
| InChIKey | WRCCCGISYYLPNF-UHFFFAOYSA-N |
| XLogP | 18.74 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.89 |
| LogP ≤ 5 | 18.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |