C21H15Cl2N5 — CID 137368780
5-chloro-2-[[5-(2-chloro-4-methylphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 137368780) has the molecular formula C21H15Cl2N5 and a molecular weight of 408.29 g/mol. Its IUPAC name is 5-chloro-2-[[5-(2-chloro-4-methylphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-[[5-(2-chloro-4-methylphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 137368780 |
| Molecular Formula | C21H15Cl2N5 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 5-chloro-2-[[5-(2-chloro-4-methylphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(-c2cccc3nc(Cc4nc5nc(Cl)ccc5[nH]4)cn23)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N5/c1-12-5-6-14(15(22)9-12)17-3-2-4-20-24-13(11-28(17)20)10-19-25-16-7-8-18(23)26-21(16)27-19/h2-9,11H,10H2,1H3,(H,25,26,27) |
| InChIKey | MKMCVAUQLJLTCH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|