C22H17Cl2N5O — CID 137368907
5-chloro-2-[[5-(2-chloro-4-ethoxyphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 137368907) has the molecular formula C22H17Cl2N5O and a molecular weight of 438.32 g/mol. Its IUPAC name is 5-chloro-2-[[5-(2-chloro-4-ethoxyphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-[[5-(2-chloro-4-ethoxyphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 137368907 |
| Molecular Formula | C22H17Cl2N5O |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 5-chloro-2-[[5-(2-chloro-4-ethoxyphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | CCOc1ccc(-c2cccc3nc(Cc4nc5nc(Cl)ccc5[nH]4)cn23)c(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2N5O/c1-2-30-14-6-7-15(16(23)11-14)18-4-3-5-21-25-13(12-29(18)21)10-20-26-17-8-9-19(24)27-22(17)28-20/h3-9,11-12H,2,10H2,1H3,(H,26,27,28) |
| InChIKey | QADICWVRJIPQMX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|