C58H28F6N4S2 — CID 137368928
2,3-di(dibenzothiophen-2-yl)-5,6-bis[2-(trifluoromethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile (PubChem CID 137368928) has the molecular formula C58H28F6N4S2 and a molecular weight of 959.01 g/mol. Its IUPAC name is 2,3-di(dibenzothiophen-2-yl)-5,6-bis[2-(trifluoromethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile.
| Compound Name | 2,3-di(dibenzothiophen-2-yl)-5,6-bis[2-(trifluoromethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 137368928 |
| Molecular Formula | C58H28F6N4S2 |
| Molecular Weight | 959.01 g/mol |
| Exact Mass | 958.17 |
| IUPAC Name | 2,3-di(dibenzothiophen-2-yl)-5,6-bis[2-(trifluoromethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccc3sc4ccccc4c3c2)c(-c2ccc3sc4ccccc4c3c2)c(C#N)c(-n2c3ccccc3c3ccc(C(F)(F)F)cc32)c1-n1c2ccccc2c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C58H28F6N4S2/c59-57(60,61)33-19-21-37-35-9-1-5-13-45(35)67(47(37)27-33)55-43(29-65)53(31-17-23-51-41(25-31)39-11-3-7-15-49(39)69-51)54(32-18-24-52-42(26-32)40-12-4-8-16-50(40)70-52)44(30-66)56(55)68-46-14-6-2-10-36(46)38-22-20-34(28-48(38)68)58(62,63)64/h1-28H |
| InChIKey | BADZCQUCWOHQOZ-UHFFFAOYSA-N |
| XLogP | 17.73 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.01 |
| LogP ≤ 5 | 17.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |