C60H26F12N4S2 — CID 137369147
2,3-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-5,6-di(dibenzothiophen-1-yl)benzene-1,4-dicarbonitrile (PubChem CID 137369147) has the molecular formula C60H26F12N4S2 and a molecular weight of 1095.01 g/mol. Its IUPAC name is 2,3-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-5,6-di(dibenzothiophen-1-yl)benzene-1,4-dicarbonitrile.
| Compound Name | 2,3-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-5,6-di(dibenzothiophen-1-yl)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 137369147 |
| Molecular Formula | C60H26F12N4S2 |
| Molecular Weight | 1095.01 g/mol |
| Exact Mass | 1094.14 |
| IUPAC Name | 2,3-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-5,6-di(dibenzothiophen-1-yl)benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1c(-c2cccc3sc4ccccc4c23)c(-c2cccc3sc4ccccc4c23)c(C#N)c(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c1-n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C60H26F12N4S2/c61-57(62,63)29-15-19-43-37(23-29)38-24-30(58(64,65)66)16-20-44(38)75(43)55-41(27-73)53(35-9-5-13-49-51(35)33-7-1-3-11-47(33)77-49)54(36-10-6-14-50-52(36)34-8-2-4-12-48(34)78-50)42(28-74)56(55)76-45-21-17-31(59(67,68)69)25-39(45)40-26-32(60(70,71)72)18-22-46(40)76/h1-26H |
| InChIKey | KCSUPNRVQWOKOU-UHFFFAOYSA-N |
| XLogP | 19.77 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.01 |
| LogP ≤ 5 | 19.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |