About 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid
7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid (PubChem CID 137369609) has the molecular formula C13H9FO2S
and a molecular weight of 248.28 g/mol. Its IUPAC name is 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid.
Analyze 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid?
The IUPAC name of 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid (CID 137369609) is 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid.
What is the SMILES notation for 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid?
The canonical SMILES for 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid is O=C(O)c1cc2c(s1)-c1ccc(F)cc1CC2.
What is the InChIKey of 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid?
The InChIKey is JJZNTNSOGADPIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FO2S/c14-9-3-4-10-7(5-9)1-2-8-6-11(13(15)16)17-12(8)10/h3-6H,1-2H2,(H,15,16).
What are the key properties of 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid?
7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid has a molecular weight of 248.28 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid is sourced from PubChem (CID 137369609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).