About 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid
6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid (PubChem CID 137370289) has the molecular formula C14H11ClO2S
and a molecular weight of 278.76 g/mol. Its IUPAC name is 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid |
| PubChem CID | 137370289 |
| Molecular Formula | C14H11ClO2S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid |
| SMILES | Cc1ccc2c(c1Cl)CCc1cc(C(=O)O)sc1-2 |
| InChI | InChI=1S/C14H11ClO2S/c1-7-2-4-10-9(12(7)15)5-3-8-6-11(14(16)17)18-13(8)10/h2,4,6H,3,5H2,1H3,(H,16,17) |
| InChIKey | SCGXLVBNBFZFIJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid?
The IUPAC name of 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid (CID 137370289) is 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid.
What is the SMILES notation for 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid?
The canonical SMILES for 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid is Cc1ccc2c(c1Cl)CCc1cc(C(=O)O)sc1-2.
What is the InChIKey of 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid?
The InChIKey is SCGXLVBNBFZFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClO2S/c1-7-2-4-10-9(12(7)15)5-3-8-6-11(14(16)17)18-13(8)10/h2,4,6H,3,5H2,1H3,(H,16,17).
What are the key properties of 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid?
6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid has a molecular weight of 278.76 g/mol, XLogP of 4.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid is sourced from PubChem (CID 137370289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).