C35H68N8O2 — CID 137370331
2-[[4,6-bis[butyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 137370331) has the molecular formula C35H68N8O2 and a molecular weight of 632.98 g/mol. Its IUPAC name is 2-[[4,6-bis[butyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[4,6-bis[butyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 137370331 |
| Molecular Formula | C35H68N8O2 |
| Molecular Weight | 632.98 g/mol |
| Exact Mass | 632.55 |
| IUPAC Name | 2-[[4,6-bis[butyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCCN(c1nc(N(CCO)CCO)nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)n1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C35H68N8O2/c1-13-15-17-42(27-23-32(3,4)39(11)33(5,6)24-27)30-36-29(41(19-21-44)20-22-45)37-31(38-30)43(18-16-14-2)28-25-34(7,8)40(12)35(9,10)26-28/h27-28,44-45H,13-26H2,1-12H3 |
| InChIKey | YHQUAVWBVZQVGC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.98 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |