C12H14O6S — CID 137370403
1-(1,5,6-trihydroxycyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-3,5-diene-1,2,3-triol (PubChem CID 137370403) has the molecular formula C12H14O6S and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-(1,5,6-trihydroxycyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-3,5-diene-1,2,3-triol.
| Compound Name | 1-(1,5,6-trihydroxycyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-3,5-diene-1,2,3-triol |
|---|---|
| PubChem CID | 137370403 |
| Molecular Formula | C12H14O6S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1-(1,5,6-trihydroxycyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-3,5-diene-1,2,3-triol |
| SMILES | OC1=CC=CC(O)(SC2(O)C=CC=C(O)C2O)C1O |
| InChI | InChI=1S/C12H14O6S/c13-7-3-1-5-11(17,9(7)15)19-12(18)6-2-4-8(14)10(12)16/h1-6,9-10,13-18H |
| InChIKey | BJTDYUCVIPLXCE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|