C29H34N4O3 — CID 137371379
N-tert-butyl-1'-[[4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-2'-oxospiro[azetidine-3,3'-indole]-1-carboxamide (PubChem CID 137371379) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-tert-butyl-1'-[[4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-2'-oxospiro[azetidine-3,3'-indole]-1-carboxamide.
| Compound Name | N-tert-butyl-1'-[[4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-2'-oxospiro[azetidine-3,3'-indole]-1-carboxamide |
|---|---|
| PubChem CID | 137371379 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-tert-butyl-1'-[[4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-2'-oxospiro[azetidine-3,3'-indole]-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CC2(C1)C(=O)N(Cc1ncc3ccccc3c1CCCCO)c1ccccc12 |
| InChI | InChI=1S/C29H34N4O3/c1-28(2,3)31-27(36)32-18-29(19-32)23-13-6-7-14-25(23)33(26(29)35)17-24-22(12-8-9-15-34)21-11-5-4-10-20(21)16-30-24/h4-7,10-11,13-14,16,34H,8-9,12,15,17-19H2,1-3H3,(H,31,36) |
| InChIKey | PSXQNRCRJTZZTE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|