About 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole
5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole (PubChem CID 137371589) has the molecular formula C23H21F2N3O
and a molecular weight of 393.44 g/mol. Its IUPAC name is 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole |
| PubChem CID | 137371589 |
| Molecular Formula | C23H21F2N3O |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole |
| SMILES | CC(C)(C)Cc1ncc(-c2ccc(C(F)F)nc2-c2ccc3cccnc3c2)o1 |
| InChI | InChI=1S/C23H21F2N3O/c1-23(2,3)12-20-27-13-19(29-20)16-8-9-17(22(24)25)28-21(16)15-7-6-14-5-4-10-26-18(14)11-15/h4-11,13,22H,12H2,1-3H3 |
| InChIKey | HUHSMVFGXHPBMA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole?
The IUPAC name of 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole (CID 137371589) is 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole.
What is the SMILES notation for 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole?
The canonical SMILES for 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole is CC(C)(C)Cc1ncc(-c2ccc(C(F)F)nc2-c2ccc3cccnc3c2)o1.
What is the InChIKey of 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole?
The InChIKey is HUHSMVFGXHPBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F2N3O/c1-23(2,3)12-20-27-13-19(29-20)16-8-9-17(22(24)25)28-21(16)15-7-6-14-5-4-10-26-18(14)11-15/h4-11,13,22H,12H2,1-3H3.
What are the key properties of 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole?
5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole has a molecular weight of 393.44 g/mol, XLogP of 6.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(difluoromethyl)-2-quinolin-7-yl-3-pyridinyl]-2-(2,2-dimethylpropyl)-1,3-oxazole is sourced from PubChem (CID 137371589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).