C6H5F2N3 — CID 137371718
3,4-difluoropyridine-2-carboximidamide (PubChem CID 137371718) has the molecular formula C6H5F2N3 and a molecular weight of 157.12 g/mol. Its IUPAC name is 3,4-difluoropyridine-2-carboximidamide.
| Compound Name | 3,4-difluoropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 137371718 |
| Molecular Formula | C6H5F2N3 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 3,4-difluoropyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nccc(F)c1F |
| InChI | InChI=1S/C6H5F2N3/c7-3-1-2-11-5(4(3)8)6(9)10/h1-2H,(H3,9,10) |
| InChIKey | MUYXKMLTZXZLMM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|