About 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine
5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 137372657) has the molecular formula C19H11ClFN5S
and a molecular weight of 395.85 g/mol. Its IUPAC name is 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 137372657 |
| Molecular Formula | C19H11ClFN5S |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(-c2cc(Cl)c3ncsc3c2)n2ccnc12 |
| InChI | InChI=1S/C19H11ClFN5S/c20-13-7-11(8-14-16(13)24-9-27-14)17-15(10-1-3-12(21)4-2-10)25-18(22)19-23-5-6-26(17)19/h1-9H,(H2,22,25) |
| InChIKey | OVSNOORYGAPREO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine (CID 137372657) is 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine is Nc1nc(-c2ccc(F)cc2)c(-c2cc(Cl)c3ncsc3c2)n2ccnc12.
What is the InChIKey of 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine?
The InChIKey is OVSNOORYGAPREO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClFN5S/c20-13-7-11(8-14-16(13)24-9-27-14)17-15(10-1-3-12(21)4-2-10)25-18(22)19-23-5-6-26(17)19/h1-9H,(H2,22,25).
What are the key properties of 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine?
5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine has a molecular weight of 395.85 g/mol, XLogP of 5.05, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chloro-1,3-benzothiazol-6-yl)-6-(4-fluorophenyl)imidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 137372657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).