C24H29F2N3O3 — CID 137372835
(2-fluoro-3-methyl-4-pyridinyl) 4-[4-[(4-fluorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate (PubChem CID 137372835) has the molecular formula C24H29F2N3O3 and a molecular weight of 445.51 g/mol. Its IUPAC name is (2-fluoro-3-methyl-4-pyridinyl) 4-[4-[(4-fluorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate.
| Compound Name | (2-fluoro-3-methyl-4-pyridinyl) 4-[4-[(4-fluorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137372835 |
| Molecular Formula | C24H29F2N3O3 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (2-fluoro-3-methyl-4-pyridinyl) 4-[4-[(4-fluorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate |
| SMILES | Cc1c(OC(=O)N2CCC(CCC(C)CNC(=O)c3ccc(F)cc3)CC2)ccnc1F |
| InChI | InChI=1S/C24H29F2N3O3/c1-16(15-28-23(30)19-5-7-20(25)8-6-19)3-4-18-10-13-29(14-11-18)24(31)32-21-9-12-27-22(26)17(21)2/h5-9,12,16,18H,3-4,10-11,13-15H2,1-2H3,(H,28,30) |
| InChIKey | LBYURIGOTZJHKJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|