About (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate
(2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate (PubChem CID 137372972) has the molecular formula C25H32ClN3O3
and a molecular weight of 458.00 g/mol. Its IUPAC name is (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate |
| PubChem CID | 137372972 |
| Molecular Formula | C25H32ClN3O3 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate |
| SMILES | Cc1nccc(OC(=O)N2CCC(C(CC(C)C)N(C=O)c3ccc(Cl)cc3)CC2)c1C |
| InChI | InChI=1S/C25H32ClN3O3/c1-17(2)15-23(29(16-30)22-7-5-21(26)6-8-22)20-10-13-28(14-11-20)25(31)32-24-9-12-27-19(4)18(24)3/h5-9,12,16-17,20,23H,10-11,13-15H2,1-4H3 |
| InChIKey | NFMNWYJPTSECDM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate?
The IUPAC name of (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate (CID 137372972) is (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate.
What is the SMILES notation for (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate?
The canonical SMILES for (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate is Cc1nccc(OC(=O)N2CCC(C(CC(C)C)N(C=O)c3ccc(Cl)cc3)CC2)c1C.
What is the InChIKey of (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate?
The InChIKey is NFMNWYJPTSECDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32ClN3O3/c1-17(2)15-23(29(16-30)22-7-5-21(26)6-8-22)20-10-13-28(14-11-20)25(31)32-24-9-12-27-19(4)18(24)3/h5-9,12,16-17,20,23H,10-11,13-15H2,1-4H3.
What are the key properties of (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate?
(2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate has a molecular weight of 458.00 g/mol, XLogP of 5.64, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethyl-4-pyridinyl) 4-[1-(4-chloro-N-formylanilino)-3-methylbutyl]piperidine-1-carboxylate is sourced from PubChem (CID 137372972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).