About 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine
3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine (PubChem CID 137372990) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine |
| PubChem CID | 137372990 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine |
| SMILES | [H]/N=C/c1cc(N(C)C)cnc1N |
| InChI | InChI=1S/C8H12N4/c1-12(2)7-3-6(4-9)8(10)11-5-7/h3-5,9H,1-2H3,(H2,10,11)/b9-4+ |
| InChIKey | YVESQQYQBXYOPH-RUDMXATFSA-N |
| XLogP | 0.73 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine?
The IUPAC name of 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine (CID 137372990) is 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine.
What is the SMILES notation for 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine?
The canonical SMILES for 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine is [H]/N=C/c1cc(N(C)C)cnc1N.
What is the InChIKey of 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine?
The InChIKey is YVESQQYQBXYOPH-RUDMXATFSA-N. The full InChI is InChI=1S/C8H12N4/c1-12(2)7-3-6(4-9)8(10)11-5-7/h3-5,9H,1-2H3,(H2,10,11)/b9-4+.
What are the key properties of 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine?
3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine has a molecular weight of 164.21 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methanimidoyl-5-N,5-N-dimethylpyridine-2,5-diamine is sourced from PubChem (CID 137372990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).