C14H27N3O15P2 — CID 137373809
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2R,3S)-4-methoxybutane-1,2,3-triol (PubChem CID 137373809) has the molecular formula C14H27N3O15P2 and a molecular weight of 539.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2R,3S)-4-methoxybutane-1,2,3-triol.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2R,3S)-4-methoxybutane-1,2,3-triol |
|---|---|
| PubChem CID | 137373809 |
| Molecular Formula | C14H27N3O15P2 |
| Molecular Weight | 539.32 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2R,3S)-4-methoxybutane-1,2,3-triol |
| SMILES | COC[C@H](O)[C@H](O)CO.Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H15N3O11P2.C5H12O4/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18;1-9-3-5(8)4(7)2-6/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H2,10,11,15)(H2,16,17,18);4-8H,2-3H2,1H3/t4-,6-,7-,8-;4-,5+/m11/s1 |
| InChIKey | QPPVPPAVYQZNCY-UDTCSSHRSA-N |
| XLogP | -3.98 |
| TPSA | 293.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.32 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|