About 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile
5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile (PubChem CID 137373863) has the molecular formula C21H21N7
and a molecular weight of 371.45 g/mol. Its IUPAC name is 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile |
| PubChem CID | 137373863 |
| Molecular Formula | C21H21N7 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile |
| SMILES | Cn1nc2ccc(-c3nc(C#N)ccc3-c3cnn(CC(C)(C)C)c3)cc2n1 |
| InChI | InChI=1S/C21H21N7/c1-21(2,3)13-28-12-15(11-23-28)17-7-6-16(10-22)24-20(17)14-5-8-18-19(9-14)26-27(4)25-18/h5-9,11-12H,13H2,1-4H3 |
| InChIKey | NIYMJRQQGWUYGS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile?
The IUPAC name of 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile (CID 137373863) is 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile.
What is the SMILES notation for 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile?
The canonical SMILES for 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile is Cn1nc2ccc(-c3nc(C#N)ccc3-c3cnn(CC(C)(C)C)c3)cc2n1.
What is the InChIKey of 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile?
The InChIKey is NIYMJRQQGWUYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N7/c1-21(2,3)13-28-12-15(11-23-28)17-7-6-16(10-22)24-20(17)14-5-8-18-19(9-14)26-27(4)25-18/h5-9,11-12H,13H2,1-4H3.
What are the key properties of 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile?
5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile has a molecular weight of 371.45 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-6-(2-methylbenzotriazol-5-yl)pyridine-2-carbonitrile is sourced from PubChem (CID 137373863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).