About 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine
4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine (PubChem CID 137373889) has the molecular formula C27H18ClN5O
and a molecular weight of 463.93 g/mol. Its IUPAC name is 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine |
| PubChem CID | 137373889 |
| Molecular Formula | C27H18ClN5O |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(N(c2ccccc2)c2ccccc2)nc(N2c3ccccc3Oc3ccccc32)n1 |
| InChI | InChI=1S/C27H18ClN5O/c28-25-29-26(32(19-11-3-1-4-12-19)20-13-5-2-6-14-20)31-27(30-25)33-21-15-7-9-17-23(21)34-24-18-10-8-16-22(24)33/h1-18H |
| InChIKey | CPTHSRLMKAPLKF-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine?
The IUPAC name of 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine (CID 137373889) is 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine?
The canonical SMILES for 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine is Clc1nc(N(c2ccccc2)c2ccccc2)nc(N2c3ccccc3Oc3ccccc32)n1.
What is the InChIKey of 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine?
The InChIKey is CPTHSRLMKAPLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18ClN5O/c28-25-29-26(32(19-11-3-1-4-12-19)20-13-5-2-6-14-20)31-27(30-25)33-21-15-7-9-17-23(21)34-24-18-10-8-16-22(24)33/h1-18H.
What are the key properties of 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine?
4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine has a molecular weight of 463.93 g/mol, XLogP of 7.57, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-phenoxazin-10-yl-N,N-diphenyl-1,3,5-triazin-2-amine is sourced from PubChem (CID 137373889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).