C24H27N5 — CID 137373976
2-methyl-6-[6-methyl-3-[1-[(1-methylcyclopentyl)methyl]pyrazol-4-yl]-2-pyridinyl]indazole (PubChem CID 137373976) has the molecular formula C24H27N5 and a molecular weight of 385.52 g/mol. Its IUPAC name is 2-methyl-6-[6-methyl-3-[1-[(1-methylcyclopentyl)methyl]pyrazol-4-yl]-2-pyridinyl]indazole.
| Compound Name | 2-methyl-6-[6-methyl-3-[1-[(1-methylcyclopentyl)methyl]pyrazol-4-yl]-2-pyridinyl]indazole |
|---|---|
| PubChem CID | 137373976 |
| Molecular Formula | C24H27N5 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2-methyl-6-[6-methyl-3-[1-[(1-methylcyclopentyl)methyl]pyrazol-4-yl]-2-pyridinyl]indazole |
| SMILES | Cc1ccc(-c2cnn(CC3(C)CCCC3)c2)c(-c2ccc3cn(C)nc3c2)n1 |
| InChI | InChI=1S/C24H27N5/c1-17-6-9-21(20-13-25-29(15-20)16-24(2)10-4-5-11-24)23(26-17)18-7-8-19-14-28(3)27-22(19)12-18/h6-9,12-15H,4-5,10-11,16H2,1-3H3 |
| InChIKey | QZGNLXFQEJBPFC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |