About 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride
7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride (PubChem CID 137374615) has the molecular formula C16H22ClNO2
and a molecular weight of 295.81 g/mol. Its IUPAC name is 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride.
Molecular Properties
| Compound Name | 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride |
| PubChem CID | 137374615 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride |
| SMILES | CC(C)c1ccc2c(c1)C(=O)OC1(CC[NH2+]CC1)C2.[Cl-] |
| InChI | InChI=1S/C16H21NO2.ClH/c1-11(2)12-3-4-13-10-16(5-7-17-8-6-16)19-15(18)14(13)9-12;/h3-4,9,11,17H,5-8,10H2,1-2H3;1H |
| InChIKey | IOPIXTHCXOXLJB-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride?
The IUPAC name of 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride (CID 137374615) is 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride.
What is the SMILES notation for 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride?
The canonical SMILES for 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride is CC(C)c1ccc2c(c1)C(=O)OC1(CC[NH2+]CC1)C2.[Cl-].
What is the InChIKey of 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride?
The InChIKey is IOPIXTHCXOXLJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2.ClH/c1-11(2)12-3-4-13-10-16(5-7-17-8-6-16)19-15(18)14(13)9-12;/h3-4,9,11,17H,5-8,10H2,1-2H3;1H.
What are the key properties of 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride?
7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride has a molecular weight of 295.81 g/mol, XLogP of -1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-ylspiro[4H-isochromene-3,4'-piperidin-1-ium]-1-one chloride is sourced from PubChem (CID 137374615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).