C24H16F6N2O4 — CID 137374821
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)indole-4-carboxylic acid (PubChem CID 137374821) has the molecular formula C24H16F6N2O4 and a molecular weight of 510.39 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)indole-4-carboxylic acid.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)indole-4-carboxylic acid |
|---|---|
| PubChem CID | 137374821 |
| Molecular Formula | C24H16F6N2O4 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)indole-4-carboxylic acid |
| SMILES | CCOC(=O)C(C#N)=Cc1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cccc(C(=O)O)c12 |
| InChI | InChI=1S/C24H16F6N2O4/c1-2-36-22(35)14(10-31)8-15-12-32(19-5-3-4-18(20(15)19)21(33)34)11-13-6-16(23(25,26)27)9-17(7-13)24(28,29)30/h3-9,12H,2,11H2,1H3,(H,33,34) |
| InChIKey | LQECINKDBHXHLT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|