C39H35N3O2 — CID 137375454
3-[2-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]hexoxy]phenol (PubChem CID 137375454) has the molecular formula C39H35N3O2 and a molecular weight of 577.73 g/mol. Its IUPAC name is 3-[2-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]hexoxy]phenol.
| Compound Name | 3-[2-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]hexoxy]phenol |
|---|---|
| PubChem CID | 137375454 |
| Molecular Formula | C39H35N3O2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 3-[2-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]hexoxy]phenol |
| SMILES | CCCCC(COc1cccc(O)c1)c1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C39H35N3O2/c1-2-3-11-34(27-44-36-17-10-16-35(43)26-36)39-41-37(32-22-18-30(19-23-32)28-12-6-4-7-13-28)40-38(42-39)33-24-20-31(21-25-33)29-14-8-5-9-15-29/h4-10,12-26,34,43H,2-3,11,27H2,1H3 |
| InChIKey | FQTRZEIWFBETBB-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |